C28H32F2N4O2S — CID 138671052
N-[4-[2-[(1R,7R)-4-(2,2-difluoroethoxy)-3-thia-5,8-diazatricyclo[5.2.2.02,6]undeca-2(6),4-dien-8-yl]ethyl]cyclohexyl]quinoline-5-carboxamide (PubChem CID 138671052) has the molecular formula C28H32F2N4O2S and a molecular weight of 526.65 g/mol. Its IUPAC name is N-[4-[2-[(1R,7R)-4-(2,2-difluoroethoxy)-3-thia-5,8-diazatricyclo[5.2.2.02,6]undeca-2(6),4-dien-8-yl]ethyl]cyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[4-[2-[(1R,7R)-4-(2,2-difluoroethoxy)-3-thia-5,8-diazatricyclo[5.2.2.02,6]undeca-2(6),4-dien-8-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138671052 |
| Molecular Formula | C28H32F2N4O2S |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-[4-[2-[(1R,7R)-4-(2,2-difluoroethoxy)-3-thia-5,8-diazatricyclo[5.2.2.02,6]undeca-2(6),4-dien-8-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2C[C@H]3CC[C@@H]2c2nc(OCC(F)F)sc23)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C28H32F2N4O2S/c29-24(30)16-36-28-33-25-23-11-8-18(26(25)37-28)15-34(23)14-12-17-6-9-19(10-7-17)32-27(35)21-3-1-5-22-20(21)4-2-13-31-22/h1-5,13,17-19,23-24H,6-12,14-16H2,(H,32,35)/t17?,18-,19?,23-/m1/s1 |
| InChIKey | CBVPIRQHTXBOJR-IYUGEKBFSA-N |
| XLogP | 5.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |