C26H28F2N4O2S — CID 138671083
N-[(1R,5S)-6-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-bicyclo[3.1.0]hexanyl]quinoline-5-carboxamide (PubChem CID 138671083) has the molecular formula C26H28F2N4O2S and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[(1R,5S)-6-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-bicyclo[3.1.0]hexanyl]quinoline-5-carboxamide.
| Compound Name | N-[(1R,5S)-6-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-bicyclo[3.1.0]hexanyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138671083 |
| Molecular Formula | C26H28F2N4O2S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(1R,5S)-6-[2-[2-(2,2-difluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]-3-bicyclo[3.1.0]hexanyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1C[C@@H]2C(CCN3CCc4sc(OCC(F)F)nc4C3)[C@@H]2C1)c1cccc2ncccc12 |
| InChI | InChI=1S/C26H28F2N4O2S/c27-24(28)14-34-26-31-22-13-32(10-7-23(22)35-26)9-6-16-19-11-15(12-20(16)19)30-25(33)18-3-1-5-21-17(18)4-2-8-29-21/h1-5,8,15-16,19-20,24H,6-7,9-14H2,(H,30,33)/t15?,16?,19-,20+ |
| InChIKey | LHGJGOWVRBPLNY-BIUPVWIKSA-N |
| XLogP | 4.54 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |