C26H35F3N4OS — CID 138671105
2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide (PubChem CID 138671105) has the molecular formula C26H35F3N4OS and a molecular weight of 508.65 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138671105 |
| Molecular Formula | C26H35F3N4OS |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
| SMILES | Cc1ncc(CC(=O)NC2CCC(CCN3CCc4ccc(CCC(F)(F)F)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C26H35F3N4OS/c1-18-30-17-23(35-18)16-25(34)32-21-5-2-19(3-6-21)9-13-33-14-10-20-4-7-22(8-12-26(27,28)29)31-24(20)11-15-33/h4,7,17,19,21H,2-3,5-6,8-16H2,1H3,(H,32,34) |
| InChIKey | DEJLBFQQDJSQMU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |