C30H37F2N5O2 — CID 138671231
N-[4-[2-[2-(3,3-difluorocyclobutyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide (PubChem CID 138671231) has the molecular formula C30H37F2N5O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is N-[4-[2-[2-(3,3-difluorocyclobutyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide.
| Compound Name | N-[4-[2-[2-(3,3-difluorocyclobutyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 138671231 |
| Molecular Formula | C30H37F2N5O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | N-[4-[2-[2-(3,3-difluorocyclobutyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NC3CCC(CCN4CCc5ccc(OC6CC(F)(F)C6)nc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C30H37F2N5O2/c1-36-19-25-24(3-2-4-27(25)35-36)29(38)33-22-8-5-20(6-9-22)11-14-37-15-12-21-7-10-28(34-26(21)13-16-37)39-23-17-30(31,32)18-23/h2-4,7,10,19-20,22-23H,5-6,8-9,11-18H2,1H3,(H,33,38) |
| InChIKey | ANUOVSVJABNEPR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |