C25H37N5O2S — CID 138671314
N-[4-[2-[2-(3,3-dimethylazetidin-1-yl)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 138671314) has the molecular formula C25H37N5O2S and a molecular weight of 471.67 g/mol. Its IUPAC name is N-[4-[2-[2-(3,3-dimethylazetidin-1-yl)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[4-[2-[2-(3,3-dimethylazetidin-1-yl)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 138671314 |
| Molecular Formula | C25H37N5O2S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | N-[4-[2-[2-(3,3-dimethylazetidin-1-yl)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NC2CCC(CCN3CCc4sc(N5CC(C)(C)C5)nc4C3)CC2)on1 |
| InChI | InChI=1S/C25H37N5O2S/c1-17-12-20(32-28-17)13-23(31)26-19-6-4-18(5-7-19)8-10-29-11-9-22-21(14-29)27-24(33-22)30-15-25(2,3)16-30/h12,18-19H,4-11,13-16H2,1-3H3,(H,26,31) |
| InChIKey | NSWHWZWXBSGNEP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |