C21H30F5N3O2S — CID 138671378
N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide (PubChem CID 138671378) has the molecular formula C21H30F5N3O2S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 138671378 |
| Molecular Formula | C21H30F5N3O2S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-yl]ethyl]cyclohexyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NC1CCC(CCN2CCc3nc(OCC(F)F)sc3CC2)CC1 |
| InChI | InChI=1S/C21H30F5N3O2S/c22-18(23)13-31-20-28-16-7-11-29(12-8-17(16)32-20)10-6-14-1-3-15(4-2-14)27-19(30)5-9-21(24,25)26/h14-15,18H,1-13H2,(H,27,30) |
| InChIKey | RQEGSZHNNVVDBC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |