C25H34F3N5OS — CID 138671429
2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]acetamide (PubChem CID 138671429) has the molecular formula C25H34F3N5OS and a molecular weight of 509.64 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138671429 |
| Molecular Formula | C25H34F3N5OS |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
| SMILES | Cc1ncc(CC(=O)NC2CCC(CCN3CCc4cnc(CCC(F)(F)F)nc4CC3)CC2)s1 |
| InChI | InChI=1S/C25H34F3N5OS/c1-17-29-16-21(35-17)14-24(34)31-20-4-2-18(3-5-20)7-11-33-12-8-19-15-30-23(6-10-25(26,27)28)32-22(19)9-13-33/h15-16,18,20H,2-14H2,1H3,(H,31,34) |
| InChIKey | WAVODODXOZTZPY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |