C25H30F3N5O2S — CID 138671435
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]indazole-4-carboxamide (PubChem CID 138671435) has the molecular formula C25H30F3N5O2S and a molecular weight of 521.61 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]indazole-4-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 138671435 |
| Molecular Formula | C25H30F3N5O2S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]indazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NC3CCC(CCN4CCc5sc(OCC(F)(F)F)nc5C4)CC3)cccc2n1 |
| InChI | InChI=1S/C25H30F3N5O2S/c1-32-13-19-18(3-2-4-20(19)31-32)23(34)29-17-7-5-16(6-8-17)9-11-33-12-10-22-21(14-33)30-24(36-22)35-15-25(26,27)28/h2-4,13,16-17H,5-12,14-15H2,1H3,(H,29,34) |
| InChIKey | LXBALWXAUSOISX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |