C25H27F3N4O3S — CID 138671585
N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]oxan-3-yl]quinoline-5-carboxamide (PubChem CID 138671585) has the molecular formula C25H27F3N4O3S and a molecular weight of 520.58 g/mol. Its IUPAC name is N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]oxan-3-yl]quinoline-5-carboxamide.
| Compound Name | N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]oxan-3-yl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138671585 |
| Molecular Formula | C25H27F3N4O3S |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-[(3S,6R)-6-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]oxan-3-yl]quinoline-5-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H](CCN2CCc3sc(OCC(F)(F)F)nc3C2)OC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C25H27F3N4O3S/c26-25(27,28)15-35-24-31-21-13-32(12-9-22(21)36-24)11-8-17-7-6-16(14-34-17)30-23(33)19-3-1-5-20-18(19)4-2-10-29-20/h1-5,10,16-17H,6-9,11-15H2,(H,30,33)/t16-,17+/m0/s1 |
| InChIKey | VOHRIFJWKDCAAD-DLBZAZTESA-N |
| XLogP | 4.36 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |