About (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile
(2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile (PubChem CID 138671728) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile.
Molecular Properties
| Compound Name | (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile |
| PubChem CID | 138671728 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile |
| SMILES | C=C/C(C#N)=C(N)\C=C/CC#N |
| InChI | InChI=1S/C9H9N3/c1-2-8(7-11)9(12)5-3-4-6-10/h2-3,5H,1,4,12H2/b5-3-,9-8- |
| InChIKey | IZBGYCDURQXVHS-MLBMHQFOSA-N |
| XLogP | 1.38 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile?
The IUPAC name of (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile (CID 138671728) is (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile.
What is the SMILES notation for (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile?
The canonical SMILES for (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile is C=C/C(C#N)=C(N)\C=C/CC#N.
What is the InChIKey of (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile?
The InChIKey is IZBGYCDURQXVHS-MLBMHQFOSA-N. The full InChI is InChI=1S/C9H9N3/c1-2-8(7-11)9(12)5-3-4-6-10/h2-3,5H,1,4,12H2/b5-3-,9-8-.
What are the key properties of (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile?
(2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile has a molecular weight of 159.19 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-3-amino-2-ethenylhepta-2,4-dienedinitrile is sourced from PubChem (CID 138671728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).