About N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine
N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine (PubChem CID 138671769) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine |
| PubChem CID | 138671769 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine |
| SMILES | C=N/C=C(C)\C=C1\C=CC=CC1 |
| InChI | InChI=1S/C11H13N/c1-10(9-12-2)8-11-6-4-3-5-7-11/h3-6,8-9H,2,7H2,1H3/b10-9-,11-8- |
| InChIKey | YTARJHVDGVJJCE-QCTTUENDSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine?
The IUPAC name of N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine (CID 138671769) is N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine.
What is the SMILES notation for N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine?
The canonical SMILES for N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine is C=N/C=C(C)\C=C1\C=CC=CC1.
What is the InChIKey of N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine?
The InChIKey is YTARJHVDGVJJCE-QCTTUENDSA-N. The full InChI is InChI=1S/C11H13N/c1-10(9-12-2)8-11-6-4-3-5-7-11/h3-6,8-9H,2,7H2,1H3/b10-9-,11-8-.
What are the key properties of N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine?
N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine has a molecular weight of 159.23 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z,3E)-3-cyclohexa-2,4-dien-1-ylidene-2-methylprop-1-enyl]methanimine is sourced from PubChem (CID 138671769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).