C9H12F2N2OS — CID 138671840
2-(2,2-difluoropropoxy)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 138671840) has the molecular formula C9H12F2N2OS and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-(2,2-difluoropropoxy)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-(2,2-difluoropropoxy)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 138671840 |
| Molecular Formula | C9H12F2N2OS |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(2,2-difluoropropoxy)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CC(F)(F)COc1nc2c(s1)CCNC2 |
| InChI | InChI=1S/C9H12F2N2OS/c1-9(10,11)5-14-8-13-6-4-12-3-2-7(6)15-8/h12H,2-5H2,1H3 |
| InChIKey | BGKXLQYPACTKNP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |