C27H23F7N4O3S — CID 138672176
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(fluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide (PubChem CID 138672176) has the molecular formula C27H23F7N4O3S and a molecular weight of 616.56 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(fluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(fluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138672176 |
| Molecular Formula | C27H23F7N4O3S |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(fluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccc(S(=O)(=O)N2CCC(CF)CC2)c1 |
| InChI | InChI=1S/C27H23F7N4O3S/c28-15-16-5-8-38(9-6-16)42(40,41)22-3-1-2-17(12-22)23(24(35)39)14-21-4-7-36-25(37-21)18-10-19(26(29,30)31)13-20(11-18)27(32,33)34/h1-4,7,10-14,16H,5-6,8-9,15H2,(H2,35,39)/b23-14+ |
| InChIKey | APZWKSAHMFMYJJ-OEAKJJBVSA-N |
| XLogP | 5.58 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|