C20H24FNO3 — CID 138672704
3-fluoro-4-[5-(2-propylpentoxy)-2-pyridinyl]benzoic acid (PubChem CID 138672704) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-fluoro-4-[5-(2-propylpentoxy)-2-pyridinyl]benzoic acid.
| Compound Name | 3-fluoro-4-[5-(2-propylpentoxy)-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 138672704 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-fluoro-4-[5-(2-propylpentoxy)-2-pyridinyl]benzoic acid |
| SMILES | CCCC(CCC)COc1ccc(-c2ccc(C(=O)O)cc2F)nc1 |
| InChI | InChI=1S/C20H24FNO3/c1-3-5-14(6-4-2)13-25-16-8-10-19(22-12-16)17-9-7-15(20(23)24)11-18(17)21/h7-12,14H,3-6,13H2,1-2H3,(H,23,24) |
| InChIKey | QDPXLMWBKHYNRZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |