C28H33F6N3O3 — CID 138672725
[(2S)-1-[3-[2-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]phenyl]oxiran-2-yl]-2-methylpyrrolidin-2-yl]methanol (PubChem CID 138672725) has the molecular formula C28H33F6N3O3 and a molecular weight of 573.58 g/mol. Its IUPAC name is [(2S)-1-[3-[2-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]phenyl]oxiran-2-yl]-2-methylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[3-[2-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]phenyl]oxiran-2-yl]-2-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 138672725 |
| Molecular Formula | C28H33F6N3O3 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | [(2S)-1-[3-[2-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]phenyl]oxiran-2-yl]-2-methylpyrrolidin-2-yl]methanol |
| SMILES | C[C@@]1(CO)CCCN1C1OC1c1ccc(-c2ccc(OCC3CCN(CC(F)(F)C(F)(F)F)CC3)cn2)cc1F |
| InChI | InChI=1S/C28H33F6N3O3/c1-26(17-38)9-2-10-37(26)25-24(40-25)21-5-3-19(13-22(21)29)23-6-4-20(14-35-23)39-15-18-7-11-36(12-8-18)16-27(30,31)28(32,33)34/h3-6,13-14,18,24-25,38H,2,7-12,15-17H2,1H3/t24?,25?,26-/m0/s1 |
| InChIKey | LQPHBCJGIJUOKJ-WNMGUVTHSA-N |
| XLogP | 5.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|