C26H39F — CID 138672767
4-[(3Z,5E)-9-ethyldodeca-1,3,5-trien-5-yl]-2-fluoro-1-(3-methylpentyl)benzene (PubChem CID 138672767) has the molecular formula C26H39F and a molecular weight of 370.60 g/mol. Its IUPAC name is 4-[(3Z,5E)-9-ethyldodeca-1,3,5-trien-5-yl]-2-fluoro-1-(3-methylpentyl)benzene.
| Compound Name | 4-[(3Z,5E)-9-ethyldodeca-1,3,5-trien-5-yl]-2-fluoro-1-(3-methylpentyl)benzene |
|---|---|
| PubChem CID | 138672767 |
| Molecular Formula | C26H39F |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 4-[(3Z,5E)-9-ethyldodeca-1,3,5-trien-5-yl]-2-fluoro-1-(3-methylpentyl)benzene |
| SMILES | C=C/C=C\C(=C/CCC(CC)CCC)c1ccc(CCC(C)CC)c(F)c1 |
| InChI | InChI=1S/C26H39F/c1-6-10-14-23(15-11-13-22(9-4)12-7-2)25-19-18-24(26(27)20-25)17-16-21(5)8-3/h6,10,14-15,18-22H,1,7-9,11-13,16-17H2,2-5H3/b14-10-,23-15+ |
| InChIKey | YYADJJCGWHFMSF-XAFSUTENSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|