C27H32N4O5 — CID 138673228
N-hydroxy-2-[[4-[2-[4-[2-(3-methoxyazetidin-1-yl)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N',2-dimethylpropanediamide (PubChem CID 138673228) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-hydroxy-2-[[4-[2-[4-[2-(3-methoxyazetidin-1-yl)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N',2-dimethylpropanediamide.
| Compound Name | N-hydroxy-2-[[4-[2-[4-[2-(3-methoxyazetidin-1-yl)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N',2-dimethylpropanediamide |
|---|---|
| PubChem CID | 138673228 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-hydroxy-2-[[4-[2-[4-[2-(3-methoxyazetidin-1-yl)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N',2-dimethylpropanediamide |
| SMILES | CNC(=O)C(C)(C(=O)NO)N(C)C(=O)c1ccc(C#Cc2ccc(CCN3CC(OC)C3)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O5/c1-27(25(33)28-2,26(34)29-35)30(3)24(32)22-13-11-20(12-14-22)6-5-19-7-9-21(10-8-19)15-16-31-17-23(18-31)36-4/h7-14,23,35H,15-18H2,1-4H3,(H,28,33)(H,29,34) |
| InChIKey | BIPPYNNOQMFIEB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|