C20H18N4O3S2 — CID 138673575
2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-N-(4-pyridin-3-ylphenyl)prop-2-enamide (PubChem CID 138673575) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-N-(4-pyridin-3-ylphenyl)prop-2-enamide.
| Compound Name | 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-N-(4-pyridin-3-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 138673575 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-N-(4-pyridin-3-ylphenyl)prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(-c2cccnc2)cc1)c1csc(NS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C20H18N4O3S2/c1-13(18-12-28-20(23-18)24-29(26,27)17-8-9-17)19(25)22-16-6-4-14(5-7-16)15-3-2-10-21-11-15/h2-7,10-12,17H,1,8-9H2,(H,22,25)(H,23,24) |
| InChIKey | XMZRTRMAMMDSNN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|