About ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate
ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate (PubChem CID 138673749) has the molecular formula C10H12F2N2O4S2
and a molecular weight of 326.35 g/mol. Its IUPAC name is ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate |
| PubChem CID | 138673749 |
| Molecular Formula | C10H12F2N2O4S2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1csc(NS(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C10H12F2N2O4S2/c1-2-18-8(15)10(11,12)7-5-19-9(13-7)14-20(16,17)6-3-4-6/h5-6H,2-4H2,1H3,(H,13,14) |
| InChIKey | WEKYQNWNZKIGKD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate?
The IUPAC name of ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate (CID 138673749) is ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1csc(NS(=O)(=O)C2CC2)n1.
What is the InChIKey of ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate?
The InChIKey is WEKYQNWNZKIGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O4S2/c1-2-18-8(15)10(11,12)7-5-19-9(13-7)14-20(16,17)6-3-4-6/h5-6H,2-4H2,1H3,(H,13,14).
What are the key properties of ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate?
ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate has a molecular weight of 326.35 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]-2,2-difluoroacetate is sourced from PubChem (CID 138673749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).