C15H22N2O5 — CID 138673915
3,4-diethyl-4-morpholin-4-yl-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 138673915) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3,4-diethyl-4-morpholin-4-yl-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | 3,4-diethyl-4-morpholin-4-yl-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 138673915 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3,4-diethyl-4-morpholin-4-yl-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | CCC1=C(C(=O)O)NC(C(=O)O)=CC1(CC)N1CCOCC1 |
| InChI | InChI=1S/C15H22N2O5/c1-3-10-12(14(20)21)16-11(13(18)19)9-15(10,4-2)17-5-7-22-8-6-17/h9,16H,3-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | OEPPAPXQSBGVCP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |