About 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole
2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole (PubChem CID 138674335) has the molecular formula C25H20FN3O
and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole |
| PubChem CID | 138674335 |
| Molecular Formula | C25H20FN3O |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole |
| SMILES | Fc1ccccc1-c1ccc(CCCc2nnc(-c3ccc4[nH]ccc4c3)o2)cc1 |
| InChI | InChI=1S/C25H20FN3O/c26-22-6-2-1-5-21(22)18-10-8-17(9-11-18)4-3-7-24-28-29-25(30-24)20-12-13-23-19(16-20)14-15-27-23/h1-2,5-6,8-16,27H,3-4,7H2 |
| InChIKey | KZYCPTBGWUTMBY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole (CID 138674335) is 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole is Fc1ccccc1-c1ccc(CCCc2nnc(-c3ccc4[nH]ccc4c3)o2)cc1.
What is the InChIKey of 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole?
The InChIKey is KZYCPTBGWUTMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20FN3O/c26-22-6-2-1-5-21(22)18-10-8-17(9-11-18)4-3-7-24-28-29-25(30-24)20-12-13-23-19(16-20)14-15-27-23/h1-2,5-6,8-16,27H,3-4,7H2.
What are the key properties of 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole?
2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole has a molecular weight of 397.45 g/mol, XLogP of 6.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(2-fluorophenyl)phenyl]propyl]-5-(1H-indol-5-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 138674335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).