C22H31N5O — CID 138674558
1-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]-3-(2-methylcyclohexyl)urea (PubChem CID 138674558) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]-3-(2-methylcyclohexyl)urea.
| Compound Name | 1-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]-3-(2-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 138674558 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 1-[3-(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)propyl]-3-(2-methylcyclohexyl)urea |
| SMILES | CC1CCCCC1NC(=O)NCCCc1nnc(C2CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H31N5O/c1-16-8-5-6-11-19(16)24-22(28)23-15-7-12-20-25-26-21(17-13-14-17)27(20)18-9-3-2-4-10-18/h2-4,9-10,16-17,19H,5-8,11-15H2,1H3,(H2,23,24,28) |
| InChIKey | VLTXLMXITFPPQX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|