About methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate
methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate (PubChem CID 138675484) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate.
Molecular Properties
| Compound Name | methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate |
| PubChem CID | 138675484 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)Oc1ccc(OC)nc1C1(CC1)C2 |
| InChI | InChI=1S/C18H17NO4/c1-21-15-6-5-13-16(19-15)18(7-8-18)10-12-4-3-11(17(20)22-2)9-14(12)23-13/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | LJIXOUDEKAPIFX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate?
The IUPAC name of methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate (CID 138675484) is methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate.
What is the SMILES notation for methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate?
The canonical SMILES for methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate is COC(=O)c1ccc2c(c1)Oc1ccc(OC)nc1C1(CC1)C2.
What is the InChIKey of methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate?
The InChIKey is LJIXOUDEKAPIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4/c1-21-15-6-5-13-16(19-15)18(7-8-18)10-12-4-3-11(17(20)22-2)9-14(12)23-13/h3-6,9H,7-8,10H2,1-2H3.
What are the key properties of methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate?
methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate has a molecular weight of 311.34 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxyspiro[6H-[1]benzoxepino[3,2-b]pyridine-5,1'-cyclopropane]-9-carboxylate is sourced from PubChem (CID 138675484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).