About 5-bromo-3-ethyl-2,4-difluorobenzaldehyde
5-bromo-3-ethyl-2,4-difluorobenzaldehyde (PubChem CID 138676739) has the molecular formula C9H7BrF2O
and a molecular weight of 249.05 g/mol. Its IUPAC name is 5-bromo-3-ethyl-2,4-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 5-bromo-3-ethyl-2,4-difluorobenzaldehyde |
| PubChem CID | 138676739 |
| Molecular Formula | C9H7BrF2O |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 5-bromo-3-ethyl-2,4-difluorobenzaldehyde |
| SMILES | CCc1c(F)c(Br)cc(C=O)c1F |
| InChI | InChI=1S/C9H7BrF2O/c1-2-6-8(11)5(4-13)3-7(10)9(6)12/h3-4H,2H2,1H3 |
| InChIKey | RQNGYFDVYDJORH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-ethyl-2,4-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-ethyl-2,4-difluorobenzaldehyde?
The IUPAC name of 5-bromo-3-ethyl-2,4-difluorobenzaldehyde (CID 138676739) is 5-bromo-3-ethyl-2,4-difluorobenzaldehyde.
What is the SMILES notation for 5-bromo-3-ethyl-2,4-difluorobenzaldehyde?
The canonical SMILES for 5-bromo-3-ethyl-2,4-difluorobenzaldehyde is CCc1c(F)c(Br)cc(C=O)c1F.
What is the InChIKey of 5-bromo-3-ethyl-2,4-difluorobenzaldehyde?
The InChIKey is RQNGYFDVYDJORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF2O/c1-2-6-8(11)5(4-13)3-7(10)9(6)12/h3-4H,2H2,1H3.
What are the key properties of 5-bromo-3-ethyl-2,4-difluorobenzaldehyde?
5-bromo-3-ethyl-2,4-difluorobenzaldehyde has a molecular weight of 249.05 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-ethyl-2,4-difluorobenzaldehyde is sourced from PubChem (CID 138676739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).