About diheptyl 2-octylhexanedioate
diheptyl 2-octylhexanedioate (PubChem CID 138677081) has the molecular formula C28H54O4
and a molecular weight of 454.74 g/mol. Its IUPAC name is diheptyl 2-octylhexanedioate.
Molecular Properties
| Compound Name | diheptyl 2-octylhexanedioate |
| PubChem CID | 138677081 |
| Molecular Formula | C28H54O4 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | diheptyl 2-octylhexanedioate |
| SMILES | CCCCCCCCC(CCCC(=O)OCCCCCCC)C(=O)OCCCCCCC |
| InChI | InChI=1S/C28H54O4/c1-4-7-10-13-14-17-21-26(28(30)32-25-19-16-12-9-6-3)22-20-23-27(29)31-24-18-15-11-8-5-2/h26H,4-25H2,1-3H3 |
| InChIKey | HXYLPJOGCCMRFL-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diheptyl 2-octylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diheptyl 2-octylhexanedioate?
The IUPAC name of diheptyl 2-octylhexanedioate (CID 138677081) is diheptyl 2-octylhexanedioate.
What is the SMILES notation for diheptyl 2-octylhexanedioate?
The canonical SMILES for diheptyl 2-octylhexanedioate is CCCCCCCCC(CCCC(=O)OCCCCCCC)C(=O)OCCCCCCC.
What is the InChIKey of diheptyl 2-octylhexanedioate?
The InChIKey is HXYLPJOGCCMRFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H54O4/c1-4-7-10-13-14-17-21-26(28(30)32-25-19-16-12-9-6-3)22-20-23-27(29)31-24-18-15-11-8-5-2/h26H,4-25H2,1-3H3.
What are the key properties of diheptyl 2-octylhexanedioate?
diheptyl 2-octylhexanedioate has a molecular weight of 454.74 g/mol, XLogP of 8.55, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diheptyl 2-octylhexanedioate is sourced from PubChem (CID 138677081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).