About [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate
[1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate (PubChem CID 138677621) has the molecular formula C9H12N4O13
and a molecular weight of 384.21 g/mol. Its IUPAC name is [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate.
Molecular Properties
| Compound Name | [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate |
| PubChem CID | 138677621 |
| Molecular Formula | C9H12N4O13 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate |
| SMILES | O=C1CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])C1(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O13/c14-7-1-2-8(3-23-10(15)16,4-24-11(17)18)9(7,5-25-12(19)20)6-26-13(21)22/h1-6H2 |
| InChIKey | VHRZZYQVQPLGJQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 226.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate?
The IUPAC name of [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate (CID 138677621) is [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate.
What is the SMILES notation for [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate?
The canonical SMILES for [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate is O=C1CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])C1(CO[N+](=O)[O-])CO[N+](=O)[O-].
What is the InChIKey of [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate?
The InChIKey is VHRZZYQVQPLGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O13/c14-7-1-2-8(3-23-10(15)16,4-24-11(17)18)9(7,5-25-12(19)20)6-26-13(21)22/h1-6H2.
What are the key properties of [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate?
[1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate has a molecular weight of 384.21 g/mol, XLogP of -0.84, 12 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,2-tris(nitrooxymethyl)-3-oxocyclopentyl]methyl nitrate is sourced from PubChem (CID 138677621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).