C9H3F15 — CID 138678322
3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)oct-1-ene (PubChem CID 138678322) has the molecular formula C9H3F15 and a molecular weight of 396.09 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)oct-1-ene.
| Compound Name | 3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)oct-1-ene |
|---|---|
| PubChem CID | 138678322 |
| Molecular Formula | C9H3F15 |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,8,8,8-dodecafluoro-7-(trifluoromethyl)oct-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F15/c1-2-3(10,11)5(13,14)7(17,18)6(15,16)4(12,8(19,20)21)9(22,23)24/h2H,1H2 |
| InChIKey | XFVUEFVCOICDDE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|