C14H16ClFN2O4 — CID 138678436
[1-[2-(4-chloro-3-fluorophenoxy)acetyl]piperidin-4-yl]carbamic acid (PubChem CID 138678436) has the molecular formula C14H16ClFN2O4 and a molecular weight of 330.74 g/mol. Its IUPAC name is [1-[2-(4-chloro-3-fluorophenoxy)acetyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[2-(4-chloro-3-fluorophenoxy)acetyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 138678436 |
| Molecular Formula | C14H16ClFN2O4 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [1-[2-(4-chloro-3-fluorophenoxy)acetyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(C(=O)COc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C14H16ClFN2O4/c15-11-2-1-10(7-12(11)16)22-8-13(19)18-5-3-9(4-6-18)17-14(20)21/h1-2,7,9,17H,3-6,8H2,(H,20,21) |
| InChIKey | XGUXJMPLHVNJLK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |