C13H15N5O3 — CID 138678517
2-amino-9-[(1R,3S,4S)-3-ethynyl-4-hydroxy-3-(hydroxymethyl)cyclopentyl]-1H-purin-6-one (PubChem CID 138678517) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-amino-9-[(1R,3S,4S)-3-ethynyl-4-hydroxy-3-(hydroxymethyl)cyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,3S,4S)-3-ethynyl-4-hydroxy-3-(hydroxymethyl)cyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 138678517 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-amino-9-[(1R,3S,4S)-3-ethynyl-4-hydroxy-3-(hydroxymethyl)cyclopentyl]-1H-purin-6-one |
| SMILES | C#C[C@]1(CO)C[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@@H]1O |
| InChI | InChI=1S/C13H15N5O3/c1-2-13(5-19)4-7(3-8(13)20)18-6-15-9-10(18)16-12(14)17-11(9)21/h1,6-8,19-20H,3-5H2,(H3,14,16,17,21)/t7-,8-,13+/m0/s1 |
| InChIKey | QDGFOSBZTHTUFW-UVPNAGLESA-N |
| XLogP | -0.99 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|