C26H25FN4O3 — CID 138678765
(7R)-15-(2-fluoro-6-hydroxyphenyl)-9,14,16-trimethyl-5-prop-2-enoyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(18),10,12,14,16-pentaen-8-one (PubChem CID 138678765) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is (7R)-15-(2-fluoro-6-hydroxyphenyl)-9,14,16-trimethyl-5-prop-2-enoyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(18),10,12,14,16-pentaen-8-one.
| Compound Name | (7R)-15-(2-fluoro-6-hydroxyphenyl)-9,14,16-trimethyl-5-prop-2-enoyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(18),10,12,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 138678765 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (7R)-15-(2-fluoro-6-hydroxyphenyl)-9,14,16-trimethyl-5-prop-2-enoyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(18),10,12,14,16-pentaen-8-one |
| SMILES | C=CC(=O)N1CCN2c3c(cnc4c(C)c(-c5c(O)cccc5F)c(C)cc34)N(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C26H25FN4O3/c1-5-21(33)30-9-10-31-19(13-30)26(34)29(4)18-12-28-24-15(3)22(14(2)11-16(24)25(18)31)23-17(27)7-6-8-20(23)32/h5-8,11-12,19,32H,1,9-10,13H2,2-4H3/t19-/m1/s1 |
| InChIKey | DQGAMQCZKDUQCD-LJQANCHMSA-N |
| XLogP | 3.54 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|