C22H21N5O3 — CID 138679008
1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 138679008) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 138679008 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(c2nc(C#Cc3cc(OC)cc(OC)c3)c3c(N)nccn23)C1 |
| InChI | InChI=1S/C22H21N5O3/c1-4-19(28)26-12-15(13-26)22-25-18(20-21(23)24-7-8-27(20)22)6-5-14-9-16(29-2)11-17(10-14)30-3/h4,7-11,15H,1,12-13H2,2-3H3,(H2,23,24) |
| InChIKey | BKNHIRCVBVWAHB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|