About 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine
2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine (PubChem CID 138679780) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine.
Molecular Properties
| Compound Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine |
| PubChem CID | 138679780 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine |
| SMILES | NC(N)=NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H10N4O2/c8-7(9)10-3-4-11-5(12)1-2-6(11)13/h1-2H,3-4H2,(H4,8,9,10) |
| InChIKey | TYEGYBVQCHLGIG-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine?
The IUPAC name of 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine (CID 138679780) is 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine.
What is the SMILES notation for 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine?
The canonical SMILES for 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine is NC(N)=NCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine?
The InChIKey is TYEGYBVQCHLGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c8-7(9)10-3-4-11-5(12)1-2-6(11)13/h1-2H,3-4H2,(H4,8,9,10).
What are the key properties of 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine?
2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine has a molecular weight of 182.18 g/mol, XLogP of -1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dioxopyrrol-1-yl)ethyl]guanidine is sourced from PubChem (CID 138679780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).