C23H24F4N2O4 — CID 138680031
[(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate;2,2,2-trifluoroacetate (PubChem CID 138680031) has the molecular formula C23H24F4N2O4 and a molecular weight of 468.45 g/mol. Its IUPAC name is [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 138680031 |
| Molecular Formula | C23H24F4N2O4 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(4-fluoro-2-phenylphenyl)carbamate;2,2,2-trifluoroacetate |
| SMILES | C[N+]12CCC(CC1)[C@@H](OC(=O)Nc1ccc(F)cc1-c1ccccc1)C2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C21H23FN2O2.C2HF3O2/c1-24-11-9-16(10-12-24)20(14-24)26-21(25)23-19-8-7-17(22)13-18(19)15-5-3-2-4-6-15;3-2(4,5)1(6)7/h2-8,13,16,20H,9-12,14H2,1H3;(H,6,7)/t16?,20-,24?;/m0./s1 |
| InChIKey | BTKSBPWAJVEZMX-IZZAMOLZSA-N |
| XLogP | 3.58 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|