C14H26O4 — CID 138680184
diethyl 2,2-diethylhexanedioate (PubChem CID 138680184) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is diethyl 2,2-diethylhexanedioate.
| Compound Name | diethyl 2,2-diethylhexanedioate |
|---|---|
| PubChem CID | 138680184 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | diethyl 2,2-diethylhexanedioate |
| SMILES | CCOC(=O)CCCC(CC)(CC)C(=O)OCC |
| InChI | InChI=1S/C14H26O4/c1-5-14(6-2,13(16)18-8-4)11-9-10-12(15)17-7-3/h5-11H2,1-4H3 |
| InChIKey | YTGIBPXVMOJUFI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |