C18H18ClF2N3O2S — CID 138680511
2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 138680511) has the molecular formula C18H18ClF2N3O2S and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 138680511 |
| Molecular Formula | C18H18ClF2N3O2S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(Cc1[nH]c(=S)n2c1CC(c1c(F)ccc(Cl)c1F)C2)N1CCOCC1 |
| InChI | InChI=1S/C18H18ClF2N3O2S/c19-11-1-2-12(20)16(17(11)21)10-7-14-13(22-18(27)24(14)9-10)8-15(25)23-3-5-26-6-4-23/h1-2,10H,3-9H2,(H,22,27) |
| InChIKey | SVCXMCRHLVQYET-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|