About 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid
4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid (PubChem CID 138680514) has the molecular formula C16H16BrF2NO5
and a molecular weight of 420.21 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid |
| PubChem CID | 138680514 |
| Molecular Formula | C16H16BrF2NO5 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)C1CC(c2c(F)ccc(Br)c2F)CN1C(=O)O |
| InChI | InChI=1S/C16H16BrF2NO5/c1-2-25-13(22)6-12(21)11-5-8(7-20(11)16(23)24)14-10(18)4-3-9(17)15(14)19/h3-4,8,11H,2,5-7H2,1H3,(H,23,24) |
| InChIKey | QBLWNNUCTCSLLD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid?
The IUPAC name of 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid (CID 138680514) is 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid.
What is the SMILES notation for 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid?
The canonical SMILES for 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid is CCOC(=O)CC(=O)C1CC(c2c(F)ccc(Br)c2F)CN1C(=O)O.
What is the InChIKey of 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid?
The InChIKey is QBLWNNUCTCSLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrF2NO5/c1-2-25-13(22)6-12(21)11-5-8(7-20(11)16(23)24)14-10(18)4-3-9(17)15(14)19/h3-4,8,11H,2,5-7H2,1H3,(H,23,24).
What are the key properties of 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid?
4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid has a molecular weight of 420.21 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2,6-difluorophenyl)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 138680514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).