C23H25N7OS — CID 138681720
6-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 138681720) has the molecular formula C23H25N7OS and a molecular weight of 447.57 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138681720 |
| Molecular Formula | C23H25N7OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 6-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(E)-(3-methylphenyl)methylideneamino]-4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)c3cc(-c4c(C)n[nH]c4C)sc3n2)c1 |
| InChI | InChI=1S/C23H25N7OS/c1-14-5-4-6-17(11-14)13-24-29-23-25-21(30-7-9-31-10-8-30)18-12-19(32-22(18)26-23)20-15(2)27-28-16(20)3/h4-6,11-13H,7-10H2,1-3H3,(H,27,28)(H,25,26,29)/b24-13+ |
| InChIKey | QKBGMPMNHURTJZ-ZMOGYAJESA-N |
| XLogP | 4.29 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|