C15H23NO3 — CID 138682301
6-(cyclopentylamino)-1,2,5,6,7,8-hexahydronaphthalene-1,2,5-triol (PubChem CID 138682301) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 6-(cyclopentylamino)-1,2,5,6,7,8-hexahydronaphthalene-1,2,5-triol.
| Compound Name | 6-(cyclopentylamino)-1,2,5,6,7,8-hexahydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 138682301 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 6-(cyclopentylamino)-1,2,5,6,7,8-hexahydronaphthalene-1,2,5-triol |
| SMILES | OC1C=CC2=C(CCC(NC3CCCC3)C2O)C1O |
| InChI | InChI=1S/C15H23NO3/c17-13-8-6-10-11(15(13)19)5-7-12(14(10)18)16-9-3-1-2-4-9/h6,8-9,12-19H,1-5,7H2 |
| InChIKey | PZPCFZFAQRTNHH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |