C32H43N3O7S2 — CID 138682428
3-[(2S)-2-hydroxy-3-[(8-naphthalen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-yl)amino]propoxy]-N-pentylbenzenesulfonamide (PubChem CID 138682428) has the molecular formula C32H43N3O7S2 and a molecular weight of 645.84 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-[(8-naphthalen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-yl)amino]propoxy]-N-pentylbenzenesulfonamide.
| Compound Name | 3-[(2S)-2-hydroxy-3-[(8-naphthalen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-yl)amino]propoxy]-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 138682428 |
| Molecular Formula | C32H43N3O7S2 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-[(8-naphthalen-2-ylsulfonyl-1-oxa-8-azaspiro[4.5]decan-3-yl)amino]propoxy]-N-pentylbenzenesulfonamide |
| SMILES | CCCCCNS(=O)(=O)c1cccc(OC[C@@H](O)CNC2COC3(CCN(S(=O)(=O)c4ccc5ccccc5c4)CC3)C2)c1 |
| InChI | InChI=1S/C32H43N3O7S2/c1-2-3-6-16-34-43(37,38)30-11-7-10-29(20-30)41-24-28(36)22-33-27-21-32(42-23-27)14-17-35(18-15-32)44(39,40)31-13-12-25-8-4-5-9-26(25)19-31/h4-5,7-13,19-20,27-28,33-34,36H,2-3,6,14-18,21-24H2,1H3/t27?,28-/m0/s1 |
| InChIKey | TVWYZJUIIHBDFZ-CPRJBALCSA-N |
| XLogP | 3.65 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|