C21H17F2N4O6P — CID 138682457
[2-amino-3-[3-[[6-(3,5-difluorophenoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 138682457) has the molecular formula C21H17F2N4O6P and a molecular weight of 490.36 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-(3,5-difluorophenoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[6-(3,5-difluorophenoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 138682457 |
| Molecular Formula | C21H17F2N4O6P |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-amino-3-[3-[[6-(3,5-difluorophenoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(Oc4cc(F)cc(F)c4)nc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C21H17F2N4O6P/c22-14-7-15(23)9-17(8-14)32-20-4-3-13(11-25-20)6-16-10-19(33-26-16)18-2-1-5-27(21(18)24)12-31-34(28,29)30/h1-5,7-11,24H,6,12H2,(H2,28,29,30) |
| InChIKey | ZMYSKGRPOGDHGC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|