C22H23N7OS — CID 138682572
N-[(E)-(3-methylphenyl)methylideneamino]-6-(1-methylpyrazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine (PubChem CID 138682572) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-6-(1-methylpyrazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-6-(1-methylpyrazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138682572 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-6-(1-methylpyrazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)c3sc(-c4cnn(C)c4)cc3n2)c1 |
| InChI | InChI=1S/C22H23N7OS/c1-15-4-3-5-16(10-15)12-23-27-22-25-18-11-19(17-13-24-28(2)14-17)31-20(18)21(26-22)29-6-8-30-9-7-29/h3-5,10-14H,6-9H2,1-2H3,(H,25,26,27)/b23-12+ |
| InChIKey | KCPSXPSYYBOBRP-FSJBWODESA-N |
| XLogP | 3.68 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|