C44H32F3IN6O3 — CID 138683103
2-[1-[4-amino-3-[3-fluoro-4-[1-[iodo(diphenyl)methyl]azetidin-3-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-5-fluoro-3-(3-fluorophenyl)chromen-4-one (PubChem CID 138683103) has the molecular formula C44H32F3IN6O3 and a molecular weight of 876.68 g/mol. Its IUPAC name is 2-[1-[4-amino-3-[3-fluoro-4-[1-[iodo(diphenyl)methyl]azetidin-3-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-5-fluoro-3-(3-fluorophenyl)chromen-4-one.
| Compound Name | 2-[1-[4-amino-3-[3-fluoro-4-[1-[iodo(diphenyl)methyl]azetidin-3-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-5-fluoro-3-(3-fluorophenyl)chromen-4-one |
|---|---|
| PubChem CID | 138683103 |
| Molecular Formula | C44H32F3IN6O3 |
| Molecular Weight | 876.68 g/mol |
| Exact Mass | 876.15 |
| IUPAC Name | 2-[1-[4-amino-3-[3-fluoro-4-[1-[iodo(diphenyl)methyl]azetidin-3-yl]oxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-5-fluoro-3-(3-fluorophenyl)chromen-4-one |
| SMILES | CC(c1oc2cccc(F)c2c(=O)c1-c1cccc(F)c1)n1nc(-c2ccc(OC3CN(C(I)(c4ccccc4)c4ccccc4)C3)c(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C44H32F3IN6O3/c1-25(41-36(26-10-8-15-30(45)20-26)40(55)37-32(46)16-9-17-35(37)57-41)54-43-38(42(49)50-24-51-43)39(52-54)27-18-19-34(33(47)21-27)56-31-22-53(23-31)44(48,28-11-4-2-5-12-28)29-13-6-3-7-14-29/h2-21,24-25,31H,22-23H2,1H3,(H2,49,50,51) |
| InChIKey | ZISIUFRHFHUGIZ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.68 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|