About (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate
(2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate (PubChem CID 138683493) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate |
| PubChem CID | 138683493 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(O)C(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C10H14O5/c1-4-7(11)9(13)8(12)5-15-10(14)6(2)3/h4,8-9,12-13H,1-2,5H2,3H3 |
| InChIKey | NIZRLRVGGWXGPQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate?
The IUPAC name of (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate (CID 138683493) is (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate.
What is the SMILES notation for (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate?
The canonical SMILES for (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate is C=CC(=O)C(O)C(O)COC(=O)C(=C)C.
What is the InChIKey of (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate?
The InChIKey is NIZRLRVGGWXGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5/c1-4-7(11)9(13)8(12)5-15-10(14)6(2)3/h4,8-9,12-13H,1-2,5H2,3H3.
What are the key properties of (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate?
(2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate has a molecular weight of 214.22 g/mol, XLogP of -0.42, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate is sourced from PubChem (CID 138683493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).