About N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide
N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 138683677) has the molecular formula C13H12F2N4O3
and a molecular weight of 310.26 g/mol. Its IUPAC name is N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 138683677 |
| Molecular Formula | C13H12F2N4O3 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | N#CC1CC(F)(F)CN1C(=O)CNC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C13H12F2N4O3/c14-13(15)3-9(4-16)19(7-13)11(21)6-18-12(22)8-1-2-10(20)17-5-8/h1-2,5,9H,3,6-7H2,(H,17,20)(H,18,22) |
| InChIKey | SSFGHIUIWAZAGR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide (CID 138683677) is N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide is N#CC1CC(F)(F)CN1C(=O)CNC(=O)c1ccc(=O)[nH]c1.
What is the InChIKey of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide?
The InChIKey is SSFGHIUIWAZAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N4O3/c14-13(15)3-9(4-16)19(7-13)11(21)6-18-12(22)8-1-2-10(20)17-5-8/h1-2,5,9H,3,6-7H2,(H,17,20)(H,18,22).
What are the key properties of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide?
N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide has a molecular weight of 310.26 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-6-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 138683677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).