About N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide
N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 138683791) has the molecular formula C14H14F2N4O3
and a molecular weight of 324.29 g/mol. Its IUPAC name is N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide |
| PubChem CID | 138683791 |
| Molecular Formula | C14H14F2N4O3 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCC(=O)N2CC(F)(F)CC2C#N)ccc1=O |
| InChI | InChI=1S/C14H14F2N4O3/c1-19-7-9(2-3-11(19)21)13(23)18-6-12(22)20-8-14(15,16)4-10(20)5-17/h2-3,7,10H,4,6,8H2,1H3,(H,18,23) |
| InChIKey | SIYMHGHAXCUYAY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide?
The IUPAC name of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide (CID 138683791) is N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide.
What is the SMILES notation for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide?
The canonical SMILES for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide is Cn1cc(C(=O)NCC(=O)N2CC(F)(F)CC2C#N)ccc1=O.
What is the InChIKey of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide?
The InChIKey is SIYMHGHAXCUYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N4O3/c1-19-7-9(2-3-11(19)21)13(23)18-6-12(22)20-8-14(15,16)4-10(20)5-17/h2-3,7,10H,4,6,8H2,1H3,(H,18,23).
What are the key properties of N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide?
N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide has a molecular weight of 324.29 g/mol, XLogP of -0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl]-1-methyl-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 138683791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).