About [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid
[1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid (PubChem CID 138683799) has the molecular formula C10H11F2N3O3
and a molecular weight of 259.21 g/mol. Its IUPAC name is [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid.
Molecular Properties
| Compound Name | [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid |
| PubChem CID | 138683799 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid |
| SMILES | N#C[C@@H]1CC(F)(F)CN1C(=O)C1(NC(=O)O)CC1 |
| InChI | InChI=1S/C10H11F2N3O3/c11-10(12)3-6(4-13)15(5-10)7(16)9(1-2-9)14-8(17)18/h6,14H,1-3,5H2,(H,17,18)/t6-/m0/s1 |
| InChIKey | SXMGHUVJGINIIP-LURJTMIESA-N |
| XLogP | 0.55 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid?
The IUPAC name of [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid (CID 138683799) is [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid.
What is the SMILES notation for [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid?
The canonical SMILES for [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid is N#C[C@@H]1CC(F)(F)CN1C(=O)C1(NC(=O)O)CC1.
What is the InChIKey of [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid?
The InChIKey is SXMGHUVJGINIIP-LURJTMIESA-N. The full InChI is InChI=1S/C10H11F2N3O3/c11-10(12)3-6(4-13)15(5-10)7(16)9(1-2-9)14-8(17)18/h6,14H,1-3,5H2,(H,17,18)/t6-/m0/s1.
What are the key properties of [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid?
[1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid has a molecular weight of 259.21 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2S)-2-cyano-4,4-difluoropyrrolidine-1-carbonyl]cyclopropyl]carbamic acid is sourced from PubChem (CID 138683799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).