C12H9BrFNO4 — CID 138683950
2-[4-bromo-5-fluoro-2-(1,2-oxazol-5-yl)phenoxy]propanoic acid (PubChem CID 138683950) has the molecular formula C12H9BrFNO4 and a molecular weight of 330.11 g/mol. Its IUPAC name is 2-[4-bromo-5-fluoro-2-(1,2-oxazol-5-yl)phenoxy]propanoic acid.
| Compound Name | 2-[4-bromo-5-fluoro-2-(1,2-oxazol-5-yl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 138683950 |
| Molecular Formula | C12H9BrFNO4 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2-[4-bromo-5-fluoro-2-(1,2-oxazol-5-yl)phenoxy]propanoic acid |
| SMILES | CC(Oc1cc(F)c(Br)cc1-c1ccno1)C(=O)O |
| InChI | InChI=1S/C12H9BrFNO4/c1-6(12(16)17)18-11-5-9(14)8(13)4-7(11)10-2-3-15-19-10/h2-6H,1H3,(H,16,17) |
| InChIKey | MGHGMLJQGRPMFG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |