C20H21F2N5O2 — CID 138684088
3-[4-[[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-hydroxyamino]-3-methylphenyl]piperidin-4-ol (PubChem CID 138684088) has the molecular formula C20H21F2N5O2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[4-[[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-hydroxyamino]-3-methylphenyl]piperidin-4-ol.
| Compound Name | 3-[4-[[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-hydroxyamino]-3-methylphenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 138684088 |
| Molecular Formula | C20H21F2N5O2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[4-[[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-hydroxyamino]-3-methylphenyl]piperidin-4-ol |
| SMILES | Cc1cc(C2CNCCC2O)ccc1N(O)c1ncn(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C20H21F2N5O2/c1-12-6-13(17-10-23-5-4-19(17)28)2-3-18(12)27(29)20-24-11-26(25-20)16-8-14(21)7-15(22)9-16/h2-3,6-9,11,17,19,23,28-29H,4-5,10H2,1H3 |
| InChIKey | ORJROLVFSWMTQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|