About benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate
benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 138684959) has the molecular formula C27H25FN4O3
and a molecular weight of 472.52 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate |
| PubChem CID | 138684959 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC[C@H]1[C@H](NC(=O)OCc2ccccc2)CC(=O)N1c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H25FN4O3/c1-2-24-23(30-27(34)35-17-18-6-4-3-5-7-18)15-26(33)31(24)22-12-13-25-19(14-22)16-29-32(25)21-10-8-20(28)9-11-21/h3-14,16,23-24H,2,15,17H2,1H3,(H,30,34)/t23-,24+/m1/s1 |
| InChIKey | UXNSPOFPYDMGKR-RPWUZVMVSA-N |
| XLogP | 4.97 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate?
The IUPAC name of benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate (CID 138684959) is benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate.
What is the SMILES notation for benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate?
The canonical SMILES for benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate is CC[C@H]1[C@H](NC(=O)OCc2ccccc2)CC(=O)N1c1ccc2c(cnn2-c2ccc(F)cc2)c1.
What is the InChIKey of benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate?
The InChIKey is UXNSPOFPYDMGKR-RPWUZVMVSA-N. The full InChI is InChI=1S/C27H25FN4O3/c1-2-24-23(30-27(34)35-17-18-6-4-3-5-7-18)15-26(33)31(24)22-12-13-25-19(14-22)16-29-32(25)21-10-8-20(28)9-11-21/h3-14,16,23-24H,2,15,17H2,1H3,(H,30,34)/t23-,24+/m1/s1.
What are the key properties of benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate?
benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate has a molecular weight of 472.52 g/mol, XLogP of 4.97, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2S,3R)-2-ethyl-1-[1-(4-fluorophenyl)indazol-5-yl]-5-oxopyrrolidin-3-yl]carbamate is sourced from PubChem (CID 138684959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).