About ethene;furan-2,3-dicarboxylic acid
ethene;furan-2,3-dicarboxylic acid (PubChem CID 138685074) has the molecular formula C8H8O5
and a molecular weight of 184.15 g/mol. Its IUPAC name is ethene;furan-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | ethene;furan-2,3-dicarboxylic acid |
| PubChem CID | 138685074 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | ethene;furan-2,3-dicarboxylic acid |
| SMILES | C=C.O=C(O)c1ccoc1C(=O)O |
| InChI | InChI=1S/C6H4O5.C2H4/c7-5(8)3-1-2-11-4(3)6(9)10;1-2/h1-2H,(H,7,8)(H,9,10);1-2H2 |
| InChIKey | MXRMZWBBMVACGZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;furan-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;furan-2,3-dicarboxylic acid?
The IUPAC name of ethene;furan-2,3-dicarboxylic acid (CID 138685074) is ethene;furan-2,3-dicarboxylic acid.
What is the SMILES notation for ethene;furan-2,3-dicarboxylic acid?
The canonical SMILES for ethene;furan-2,3-dicarboxylic acid is C=C.O=C(O)c1ccoc1C(=O)O.
What is the InChIKey of ethene;furan-2,3-dicarboxylic acid?
The InChIKey is MXRMZWBBMVACGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O5.C2H4/c7-5(8)3-1-2-11-4(3)6(9)10;1-2/h1-2H,(H,7,8)(H,9,10);1-2H2.
What are the key properties of ethene;furan-2,3-dicarboxylic acid?
ethene;furan-2,3-dicarboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;furan-2,3-dicarboxylic acid is sourced from PubChem (CID 138685074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).